A7942312
Triethoxy(3-glycidyloxypropyl)silane , >96.0%(GC) , 2602-34-8
Synonym(s):
3-(2,3-Epoxypropyloxy)propyltriethoxysilane;GPTES
CAS NO.:2602-34-8
Empirical Formula: C12H26O5Si
Molecular Weight: 278.42
MDL number: MFCD01311705
EINECS: 220-011-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB102.40 | In Stock |
|
| 500G | RMB387.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-50°C |
| Boiling point: | 270°C |
| Density | 1.004 g/mL at 20 °C (lit.) |
| vapor pressure | 0.07Pa at 25℃ |
| refractive index | n |
| Flash point: | 125°C |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Oil |
| Specific Gravity | 1.00 |
| color | Clear Colourless |
| Water Solubility | 3.3g/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 144145 |
| InChI | 1S/C12H26O5Si/c1-4-15-18(16-5-2,17-6-3)9-7-8-13-10-12-11-14-12/h12H,4-11H2,1-3H3 |
| InChIKey | JXUKBNICSRJFAP-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCOCC1CO1)(OCC)OCC |
| LogP | 2 at 20℃ |
| CAS DataBase Reference | 2602-34-8(CAS DataBase Reference) |
| EPA Substance Registry System | Oxirane, 2-[[3-(triethoxysilyl)propoxy]methyl]- (2602-34-8) |
Description and Uses
(3-Glycidyloxypropyl)triethoxysilane (GPTES) can be used as a reagent in the synthesis of: ????????
- Polymer nanocomposite membranes for direct methanol fuel cells (DMFCs).???????
- Azido terminated poly(ethylene glycol) silane that can be self-assembled on a metal-oxide surface to facilitate the orthogonal biofunctionalization.??????
- Epoxy functionalized silsesquioxane nanoparticles (SQ-NPs).
- Epoxy-functionalized mesoporous cellular foams (G-MCFs) as the support for the immobilization of penicillin G acylase (PGA).
GPTES can also be used as a precursor to prepare water-repellent, self-cleaning coatings.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P271-P302+P352-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 1-10-19 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






