A7942812
Trimethoxy(pentafluorophenyl)silane , >97.0%(GC) , 223668-64-2
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB199.20 | In Stock |
|
| 1G | RMB884.80 | In Stock |
|
| 5g | RMB1391.20 | In Stock |
|
| 25g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 184.5±40.0 °C(Predicted) |
| Density | 1.373 |
| refractive index | 1.4160 to 1.4200 |
| Flash point: | 65° |
| storage temp. | Store at room temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.373 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C9H9F5O3Si/c1-15-18(16-2,17-3)9-7(13)5(11)4(10)6(12)8(9)14/h1-3H3 |
| InChIKey | XFFHTZIRHGKTBQ-UHFFFAOYSA-N |
| SMILES | C1(F)=C([Si](OC)(OC)OC)C(F)=C(F)C(F)=C1F |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280-P261 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2931900090 |
