A7945012
Tetracaine , >98.0%(GC) , 94-24-6
Synonym(s):
4-(Butylamino)benzoic acid 2-(dimethylamino)ethyl ester;Tetracaine
CAS NO.:94-24-6
Empirical Formula: C15H24N2O2
Molecular Weight: 264.36
MDL number: MFCD00053787
EINECS: 202-316-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB288.80 | In Stock |
|
| 100G | RMB957.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41.0 to 45.0 °C |
| Boiling point: | 407.59°C (rough estimate) |
| Density | 1.0200 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | pKa 8.33±0.03(H2O
t = 20.0
I = 0.10 (KCl)) (Uncertain) |
| color | White to Almost white |
| Water Solubility | 156mg/L(temperature not stated) |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C15H24N2O2/c1-4-5-10-16-14-8-6-13(7-9-14)15(18)19-12-11-17(2)3/h6-9,16H,4-5,10-12H2,1-3H3 |
| InChIKey | GKCBAIGFKIBETG-UHFFFAOYSA-N |
| SMILES | C(OCCN(C)C)(=O)C1=CC=C(NCCCC)C=C1 |
| LogP | 3.510 |
| CAS DataBase Reference | 94-24-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetracaine(94-24-6) |
Description and Uses
analgesic
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H317-H351 |
| Precautionary statements | P280-P301+P330+P331+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-40-42/43-43 |
| Safety Statements | 22-36/37 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | DG4725000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29224999 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Skin Sens. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






