A7948112
Thiazolidine-2,4-dicarboxylic Acid , 98% , 30097-06-4
CAS NO.:30097-06-4
Empirical Formula: C5H7NO4S
Molecular Weight: 177.18
MDL number: MFCD00145399
EINECS: 250-048-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB509.60 | In Stock |
|
| 25g | RMB2051.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199-201°C |
| Boiling point: | 524.3±50.0 °C(Predicted) |
| Density | 1.629±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. -20°C |
| form | powder to crystal |
| pka | 1.12±0.40(Predicted) |
| color | White to Almost white |
| Water Solubility | 7.619g/L(21 ºC) |
| InChI | InChI=1S/C5H7NO4S/c7-4(8)2-1-11-3(6-2)5(9)10/h2-3,6H,1H2,(H,7,8)(H,9,10) |
| InChIKey | DAXBISKSIDBYEU-UHFFFAOYSA-N |
| SMILES | S1CC(C(O)=O)NC1C(O)=O |
Description and Uses
Tidiacic is a hepatoprotective agent that acts as an antioxidant and a sulfur donor[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2934.10.9000 |
| HazardClass | IRRITANT |




![DIMETHYL 3-[2-(4-METHYLPIPERAZINO)ACETYL]-1,3-THIAZOLANE-2,4-DICARBOXYLATE](https://img.chemicalbook.com/StructureFile/ChemBookStructure3/GIF/CB4686785.gif)

