A7962512
Tris(trimethylsilyloxy)silane , >98.0%(GC) , 1873-89-8
CAS NO.:1873-89-8
Empirical Formula: C9H28O3Si4
Molecular Weight: 296.66
MDL number: MFCD00054865
EINECS: 217-497-7
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB55.20 | In Stock |
|
| 5ML | RMB176.80 | In Stock |
|
| 25ML | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 185 °C (lit.) |
| Density | 0.852 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 131 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Benzene (Slightly), Chloroform (Sparingly) |
| form | clear liquid |
| Specific Gravity | 0.852 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| BRN | 1772735 |
| Stability: | Hygroscopic, Moisture sensitive |
| InChI | 1S/C9H28O3Si4/c1-14(2,3)10-13(11-15(4,5)6)12-16(7,8)9/h13H,1-9H3 |
| InChIKey | FDWGGTLVZGTDGQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P240-P241-P280a-P303+P361+P353-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| Safety Statements | 23-24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



![3-[Tris(trimethylsiloxy)silyl]propyl methacrylate](https://img.chemicalbook.com/CAS/GIF/17096-07-0.gif)


