PRODUCT Properties
| Boiling point: | 160.5-161 °C (lit.) |
| Density | 0.799 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 0.799 |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| InChI | 1S/C18H40Si/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h19H,4-18H2,1-3H3 |
| InChIKey | IBNSYFQZHBBNLR-UHFFFAOYSA-N |
| SMILES | CCCCCC[SiH](CCCCCC)CCCCCC |
| EPA Substance Registry System | Silane, trihexyl- (2929-52-4) |
Description and Uses
Reactant for:
- Enantioselective Si-H insertion
- Regio- and stereoselective oxidation into silanols
- Asymmetric carbenoid insertion of diazoacetates into the silicon-hydrogen bond
- Hydrosilylation of carbon dioxide
Catalyst for hydrodefluorination leading to the synthesis of hydrocarbons
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-38-51-36/37 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
