S857078
Trioctylsilane , 95% , 18765-09-8
CAS NO.:18765-09-8
Empirical Formula: C24H52Si
Molecular Weight: 368.76
MDL number: MFCD00053812
EINECS: 242-559-5
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB353.65 | In Stock |
|
| 25ml | RMB1186.45 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 163-165 °C/0.15 mmHg (lit.) |
| Density | 0.821 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| Specific Gravity | 0.821 |
| Appearance | Light yellow to yellow Liquid |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| InChI | InChI=1S/C24H52Si/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h25H,4-24H2,1-3H3 |
| InChIKey | JBAALNCKQCMFDH-UHFFFAOYSA-N |
| SMILES | [SiH](CCCCCCCC)(CCCCCCCC)CCCCCCCC |
| EPA Substance Registry System | Silane, trioctyl- (18765-09-8) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |







