A7964512
2,4,6-Trifluorobenzoic Acid , >98.0%(HPLC) , 28314-80-9
CAS NO.:28314-80-9
Empirical Formula: C7H3F3O2
Molecular Weight: 176.09
MDL number: MFCD00042398
EINECS: 220-603-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB95.20 | In Stock |
|
| 25g | RMB387.20 | In Stock |
|
| 100g | RMB1479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-145 °C (lit.) |
| Boiling point: | 218.2±35.0 °C(Predicted) |
| Density | 1.4362 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.28±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 1958300 |
| InChI | InChI=1S/C7H3F3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12) |
| InChIKey | SJZATRRXUILGHH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(F)C=C(F)C=C1F |
| CAS DataBase Reference | 28314-80-9(CAS DataBase Reference) |
Description and Uses
2,4,6-Trifluorobenzoic Acid is used in preparation of Difluorophenol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






