A7966412
2,4,6-Triphenyl-1,3,5-triazine (purified by sublimation) , 99% , 493-77-6
CAS NO.:493-77-6
Empirical Formula: C21H15N3
Molecular Weight: 309.36
MDL number: MFCD00006051
EINECS: 207-779-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB158.40 | In Stock |
|
| 5g | RMB511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 231-236 °C |
| Boiling point: | 230°C/0.01mmHg(lit.) |
| Density | 1.1645 (rough estimate) |
| refractive index | 1.6380 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 1.05±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| λmax | 270nm(CHCl3)(lit.) |
| InChI | InChI=1S/C21H15N3/c1-4-10-16(11-5-1)19-22-20(17-12-6-2-7-13-17)24-21(23-19)18-14-8-3-9-15-18/h1-15H |
| InChIKey | HBQUOLGAXBYZGR-UHFFFAOYSA-N |
| SMILES | N1=C(C2=CC=CC=C2)N=C(C2=CC=CC=C2)N=C1C1=CC=CC=C1 |
| EPA Substance Registry System | 1,3,5-Triazine, 2,4,6-triphenyl- (493-77-6) |
Description and Uses
2,4,6-Triphenyl-1,3,5-triazine has been used as a hole-blocking material for electroluminescent devices (ELD).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29336990 |




