A7967012
Tetraphenylsilane , >97.0% , 1048-08-4
CAS NO.:1048-08-4
Empirical Formula: C24H20Si
Molecular Weight: 336.5
MDL number: MFCD00014069
EINECS: 213-881-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB120.00 | In Stock |
|
| 1G | RMB317.60 | In Stock |
|
| 5G | RMB1254.40 | In Stock |
|
| 25g | RMB5119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 236 °C |
| Boiling point: | 228 °C |
| Density | 1.078 |
| Flash point: | 193°C |
| storage temp. | Store at room temperature |
| form | solid |
| Specific Gravity | 1.078 |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 1885911 |
| InChI | InChI=1S/C24H20Si/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | JLAVCPKULITDHO-UHFFFAOYSA-N |
| SMILES | [Si](C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 1048-08-4(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, tetraphenyl- (1048-08-4) |
Description and Uses
Heat-transfer medium, polymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Safety Statements | 22-24/25 |
| TSCA | TSCA listed |
| HS Code | 29319090 |







