LN-671779
TRIMETHYLSILANE , >=99% , 993-07-7
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | -135,9°C |
| Boiling point: | 6,7°C |
| Density | 0,638 g/cm3 |
| refractive index | 1.3800 (estimate) |
| Flash point: | <-29°C |
| form | liquid |
| Specific Gravity | 0.638 |
| Water Solubility | 1.4g/L at 20℃ |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| InChI | InChI=1S/C3H10Si/c1-4(2)3/h4H,1-3H3 |
| InChIKey | PQDJYEQOELDLCP-UHFFFAOYSA-N |
| SMILES | [SiH](C)(C)C |
| LogP | 2.2 at 20℃ |
| CAS DataBase Reference | 993-07-7 |
| EPA Substance Registry System | Silane, trimethyl- (993-07-7) |
Description and Uses
Potential reducing agent that will produce low boiling hexamethyldisiloxane by-product.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS04,GHS07 |
| Signal word | Danger |
| Hazard statements | H220-H315-H319-H335 |
| Precautionary statements | P210-P280-P321 |
| Risk Statements | 12-36/37/38 |
| Safety Statements | 9-16-26-33 |
| RIDADR | 3161 |
| TSCA | TSCA listed |
| HS Code | 2931900050 |







