A7967312
3-(Trifluoromethoxy)cinnamic Acid , >98.0% , 168833-80-5
CAS NO.:168833-80-5
Empirical Formula: C10H7F3O3
Molecular Weight: 232.16
MDL number: MFCD00066337
EINECS: 625-131-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB88.00 | In Stock |
|
| 5G | RMB627.20 | In Stock |
|
| 25G | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-96 °C (lit.) |
| Boiling point: | 286℃ |
| Density | 1.403 |
| Flash point: | 127℃ |
| storage temp. | Store at room temperature |
| solubility | very faint turbidity in Methanol |
| form | powder to crystal |
| pka | 4.27±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C10H7F3O3/c11-10(12,13)16-8-3-1-2-7(6-8)4-5-9(14)15/h1-6H,(H,14,15)/b5-4+ |
| InChIKey | CLKZZEYGXRWYNI-SNAWJCMRSA-N |
| SMILES | [H]\C(=C(\[H])c1cccc(OC(F)(F)F)c1)C(O)=O |
| CAS DataBase Reference | 168833-80-5(CAS DataBase Reference) |
Description and Uses
trans-3-(Trifluoromethoxy)cinnamic Acid (CAS# 168833-80-5) can be used to plate compounds that contain antioxidant. It can also be used to treat dysproliferative diseases.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P280a-P301+P310a-P405-P501a-P261-P301+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36-45-26/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







