A7824612
3-(Trifluoromethoxy)benzyl Bromide , 97% , 159689-88-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB58.40 | In Stock |
|
| 5G | RMB208.80 | In Stock |
|
| 25g | RMB997.60 | In Stock |
|
| 100g | RMB3873.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 179 °C(lit.) |
| Density | 1.572 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 192 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.5838 |
| Sensitive | Lachrymatory |
| BRN | 8052203 |
| InChI | InChI=1S/C8H6BrF3O/c9-5-6-2-1-3-7(4-6)13-8(10,11)12/h1-4H,5H2 |
| InChIKey | QSIVWRRHVXSDNE-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 159689-88-0(CAS DataBase Reference) |
Description and Uses
3-(Bromomethyl)trifluoromethoxybenzene is a reagent used in the preparation of aminophosphorylalkanoic acid derivatives as aminopeptidase A inhibitors.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H227-H318 |
| Precautionary statements | P280-P305+P351+P338-P310-P210e-P260h-P303+P361+P353-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29093090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
