A7967712
3,4,5-Trifluorobenzoic Acid , >98.0% , 121602-93-5
CAS NO.:121602-93-5
Empirical Formula: C7H3F3O2
Molecular Weight: 176.09
MDL number: MFCD00074962
EINECS: 624-063-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB138.40 | In Stock |
|
| 100G | RMB535.20 | In Stock |
|
| 500g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-99 °C (lit.) |
| Boiling point: | 116-118C/100Torr |
| Density | 1,12g/cm |
| refractive index | 1,471-1,473 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.46±0.10(Predicted) |
| color | White to Almost white |
| BRN | 7476737 |
| InChI | InChI=1S/C7H3F3O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12) |
| InChIKey | VJMYKESYFHYUEQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=C(F)C(F)=C1 |
| CAS DataBase Reference | 121602-93-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 3,4,5-trifluoro- (121602-93-5) |
Description and Uses
3,4,5-Trifluorobenzoic acid may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |






