A7969412
1,1,3,3-Tetramethyldisilazane , >97.0%(GC) , 15933-59-2
Synonym(s):
TMDS
CAS NO.:15933-59-2
Empirical Formula: C4H15NSi2
Molecular Weight: 133.34
MDL number: MFCD00025626
EINECS: 240-072-2
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB158.40 | In Stock |
|
| 25ML | RMB494.40 | In Stock |
|
| 100ML | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-100 °C |
| Boiling point: | 99-100 °C |
| Density | 0.752 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 17 °F |
| storage temp. | Store below +30°C. |
| solubility | Miscible with common organic solvents. |
| pka | 9.80±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.752 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 741869 |
| InChI | 1S/C4H15NSi2/c1-6(2)5-7(3)4/h5-7H,1-4H3 |
| InChIKey | NQCZAYQXPJEPDS-UHFFFAOYSA-N |
| SMILES | [H][Si](C)(C)N[Si]([H])(C)C |
| CAS DataBase Reference | 15933-59-2(CAS DataBase Reference) |
| EPA Substance Registry System | Silanamine, N-(dimethylsilyl)-1,1-dimethyl- (15933-59-2) |
Description and Uses
Tetramethyldisilazane is used as a gas chromatographic derivatizing reagent. Further, it reacts with phenol to prepare dimethylphenoxysilane. In addition, it is used in electronic, polymer and pharmaceutical industries.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |






