A7969812
Triisopropyl Orthoformate , >97.0%(GC) , 4447-60-3
CAS NO.：4447-60-3
Empirical Formula: C10H22O3
Molecular Weight: 190.28
MDL number: MFCD00060628
EINECS: 224-688-9
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB39.20 | In Stock |
|
| 5ml | RMB79.20 | In Stock |
|
| 25ML | RMB208.80 | In Stock |
|
| 100ml | RMB619.20 | In Stock |
|
| 500ml | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 65-66 °C/18 mmHg (lit.) |
| Density | 0.854 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 108 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Clear colorless |
| Sensitive | Moisture Sensitive |
| BRN | 1700668 |
| InChI | InChI=1S/C10H22O3/c1-7(2)11-10(12-8(3)4)13-9(5)6/h7-10H,1-6H3 |
| InChIKey | FPIVAWNGRDHRSQ-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(OC(C)C)OC(C)C |
| CAS DataBase Reference | 4447-60-3(CAS DataBase Reference) |
| EPA Substance Registry System | Propane, 2,2',2''-[methylidynetris(oxy)]tris- (4447-60-3) |
Description and Uses
Triisopropyl orthoformate may be used for the preparation of 2-(diisopropoxymethyl)oxirane.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36-37/39-16 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 1 |
| F | 21 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29159000 |
