A7970612
5,6,7,8-Tetrahydroisoquinoline , ≥98.0% , 36556-06-6
CAS NO.:36556-06-6
Empirical Formula: C9H11N
Molecular Weight: 133.19
MDL number: MFCD00012168
EINECS: 253-098-4
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB295.20 | In Stock |
|
| 25ML | RMB959.20 | In Stock |
|
| 100ML | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146.5°C |
| Boiling point: | 106-108 °C13 mm Hg(lit.) |
| Density | 1.03 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 212 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 6.37±0.20(Predicted) |
| form | Liquid |
| color | Clear pale yellow |
| InChI | InChI=1S/C9H11N/c1-2-4-9-7-10-6-5-8(9)3-1/h5-7H,1-4H2 |
| InChIKey | HTMGQIXFZMZZKD-UHFFFAOYSA-N |
| SMILES | C1C2=C(CCCC2)C=CN=1 |
| CAS DataBase Reference | 36556-06-6(CAS DataBase Reference) |
Description and Uses
5,6,7,8-Tetrahydroisoquinoline was used in total synthesis of (±)-desoxycodeine-D. It was also used in the synthesis of 7,8-dihydroisoquinolin-5(6H)-one.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29334900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







