A8044912
1,2,3,4-<WBR>Tetrahydro-<WBR>3-<WBR>isoquinolinecarboxylic acid hydrochloride , 96% , 41994-51-8
CAS NO.：41994-51-8
Empirical Formula: C10H11NO2
Molecular Weight: 177.2
MDL number: MFCD00191496
EINECS: 255-610-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB239.20 | In Stock |
|
| 10G | RMB719.20 | In Stock |
|
| 50g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| storage temp. | Store at room temperature |
| Appearance | White to off-white Solid |
| BRN | 3723332 |
| InChI | 1S/C10H11NO2.ClH/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H |
| InChIKey | FXHCFPUEIDRTMR-UHFFFAOYSA-N |
| SMILES | Cl[H].OC(=O)C1Cc2ccccc2CN1 |
| CAS DataBase Reference | 41994-51-8(CAS DataBase Reference) |
Description and Uses
1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid was used in the synthesis of 10,10a-dihydroimidazo-[1,5-b]isoquinoline-1,3(2H,5H)-diones, inhibitor of inflammation, apoprotein B-100 biosynthesis and matrix-degrading metalloprotienase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
