A7974612
1,3,5-Triphenylbenzene , >99.0% , 612-71-5
CAS NO.:612-71-5
Empirical Formula: C24H18
Molecular Weight: 306.4
MDL number: MFCD00003060
EINECS: 210-318-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB52.80 | In Stock |
|
| 10G | RMB76.80 | In Stock |
|
| 50G | RMB224.00 | In Stock |
|
| 250G | RMB1014.40 | In Stock |
|
| 1KG | RMB3679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-174 °C (lit.) |
| Boiling point: | 460 °C (lit.) |
| Density | 1.1990 |
| refractive index | 1.4800 (estimate) |
| Flash point: | 238 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in toluene is almost transparent. |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C24H18/c1-4-10-19(11-5-1)22-16-23(20-12-6-2-7-13-20)18-24(17-22)21-14-8-3-9-15-21/h1-18H |
| InChIKey | SXWIAEOZZQADEY-UHFFFAOYSA-N |
| SMILES | C1(C2=CC(C3=CC=CC=C3)=CC(C3=CC=CC=C3)=C2)=CC=CC=C1 |
| CAS DataBase Reference | 612-71-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1':3',1''-Terphenyl, 5'-phenyl-(612-71-5) |
| EPA Substance Registry System | 1,1':3',1''-Terphenyl, 5'-phenyl- (612-71-5) |
Description and Uses
1,3,5-Triphenylbenzene fluorophore as a selective Cu2+ sensor in aqueous media.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | WZ6530000 |
| HS Code | 29029090 |
| Storage Class | 11 - Combustible Solids |







