A7974912
4-<i>tert</i>-Butylcalix[6]arene (contains 5-10% Benzene) , >98.0%(HPLC) , 78092-53-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB107.20 | In Stock |
|
| 5G | RMB336.00 | In Stock |
|
| 25G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C(lit.) |
| Boiling point: | 784.26°C (rough estimate) |
| Density | 0.9131 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| pka | 9.35±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | <9.73mg/L(temperature not stated) |
| λmax | 286nm(CH3CN)(lit.) |
| BRN | 2611918 |
| InChIKey | UOEYZAXKBKAKRO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc2Cc3cc(cc(Cc4cc(cc(Cc5cc(cc(Cc6cc(cc(Cc7cc(cc(Cc(c1)c2O)c7O)C(C)(C)C)c6O)C(C)(C)C)c5O)C(C)(C)C)c4O)C(C)(C)C)c3O)C(C)(C)C |
Description and Uses
Starting material for further derivatization, including halogenation, acylation, and diazo coupling.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |

![4-<i>tert</i>-Butylcalix[6]arene (contains 5-10% Benzene)](https://img.chemicalbook.com/CAS/GIF/78092-53-2.gif)

![Calix[6]arene](https://img.chemicalbook.com/CAS/GIF/96107-95-8.gif)

![2,2''-Methylenebis[6-(2-hydroxy-5-methylbenzyl)-p-cresol]](https://img.chemicalbook.com/CAS/GIF/20837-68-7.gif)
![2,6-Bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol](https://img.chemicalbook.com/CAS/GIF/1620-68-4.gif)