A7978512
<i>trans</i>-1,4-Cyclohexanedimethanol , >98.0%(GC) , 3236-48-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.48 | In Stock |
|
| 5G | RMB142.40 | In Stock |
|
| 25G | RMB448.80 | In Stock |
|
| 100G | RMB1173.60 | In Stock |
|
| 500g | RMB4199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-66 °C |
| Boiling point: | 283 °C |
| Density | 1.02 |
| refractive index | 1.4390 (estimate) |
| Flash point: | >109℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, DMSO, Methanol |
| form | Crystalline Powder |
| pka | 14.75±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2/t7-,8- |
| InChIKey | YIMQCDZDWXUDCA-ZKCHVHJHSA-N |
| SMILES | [C@@H]1(CO)CC[C@@H](CO)CC1 |
| CAS DataBase Reference | 3236-48-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Cyclohexanedimethanol, trans- (3236-48-4) |
Description and Uses
Intermediate in the preparation of Apadenoson.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Risk Statements | 36 |
| Safety Statements | 39-26 |
| HS Code | 29051990 |
