PRODUCT Properties
| Melting point: | 105-107°C |
| Boiling point: | 272.3±35.0 °C(Predicted) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | Light yellow to Brown |
| Water Solubility | Soluble in methanol. Insoluble in water. |
| InChI | InChI=1S/C12H6/c1-4-10-7-11(5-2)9-12(6-3)8-10/h1-3,7-9H |
| InChIKey | ZDRMMTYSQSIGRY-UHFFFAOYSA-N |
| SMILES | C1(C#C)=CC(C#C)=CC(C#C)=C1 |
| CAS DataBase Reference | 7567-63-7(CAS DataBase Reference) |
Description and Uses
1,3,5-Triethynylbenzene is used as the carbon precursor for graphene synthesis on rhodium. It is also used as a connecting unit for various transition metal building blocks.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-20/21-36/37/38-65-36 |
| Safety Statements | 16-26-36/37/39-60-43-37-33-7 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Flammable |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29029090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |




