A7979912
1-(4-Trifluoromethylbenzyl)piperazine , >97.0%(GC) , 107890-32-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB300.80 | In Stock |
|
| 5G | RMB904.80 | In Stock |
|
| 25g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 88-89 °C0.02 mm Hg |
| Density | 1.239 g/mL at 25 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C, protect from light |
| form | clear liquid |
| pka | 9.07±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | 1S/C12H15F3N2/c13-12(14,15)11-3-1-10(2-4-11)9-17-7-5-16-6-8-17/h1-4,16H,5-9H2 |
| InChIKey | FAFAFWFQFVLXGF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(CN2CCNCC2)cc1 |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,C |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| HS Code | 2933.59.8000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![1-[4-(Trifluoromethyl)benzoyl]piperazine](https://img.chemicalbook.com/CAS/GIF/179334-12-4.gif)

