A7985712
4,4,4-Trifluoro-1-(<i>p</i>-tolyl)-1,3-butanedione , >98.0%(GC) , 720-94-5
CAS NO.：720-94-5
Empirical Formula: C11H9F3O2
Molecular Weight: 230.18
MDL number: MFCD00517909
EINECS: 615-712-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB180.00 | In Stock |
|
| 100g | RMB439.20 | In Stock |
|
| 500g | RMB1551.20 | In Stock |
|
| 2.5kg | RMB4652.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-46°C |
| Boiling point: | 269.9±35.0 °C(Predicted) |
| Density | 1.252±0.06 g/cm3(Predicted) |
| vapor pressure | 0.633Pa at 20℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 5.91±0.25(Predicted) |
| color | Off-White to Light Beige |
| Water Solubility | 526.4mg/L at 20℃ |
| InChI | InChI=1S/C11H9F3O2/c1-7-2-4-8(5-3-7)9(15)6-10(16)11(12,13)14/h2-5H,6H2,1H3 |
| InChIKey | WRZMHTIRFOFFPY-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C=C1)(=O)CC(=O)C(F)(F)F |
| LogP | 1.95 at 20℃ |
| CAS DataBase Reference | 720-94-5(CAS DataBase Reference) |
Description and Uses
A Celecoxib (Celebrex) intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2914790090 |
