A7996712
Tetramethylammonium Triacetoxyborohydride , >95.0%(T) , 109704-53-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB91.20 | In Stock |
|
| 25G | RMB367.20 | In Stock |
|
| 100G | RMB1383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-98 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | slightly sol. in dichloromethane |
| form | powder to crystal |
| color | White to Almost white |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 8238791 |
| InChI | 1S/C6H10BO6.C4H12N/c1-4(8)11-7(12-5(2)9)13-6(3)10;1-5(2,3)4/h7H,1-3H3;1-4H3/q-1;+1 |
| InChIKey | LCFZZOGKVOTFPU-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C.CC(=O)O[BH-](OC(C)=O)OC(C)=O |
Description and Uses
Selective reducing agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H261-H315-H319-H335 |
| Precautionary statements | P223-P231+P232-P261-P264-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xi |
| Risk Statements | 15-36/37/38 |
| Safety Statements | 26-36-43 |
| RIDADR | UN 2813 4.3/PG 2 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HazardClass | 4.3 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 Water-react 2 |
| Limited Quantities | 0.5 Kg (1.1 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







