A7997912
Triphenyl Borate , >95.0% , 1095-03-0
Synonym(s):
NSC 806;Triphenoxyborane;Triphenyl ester boric acid
CAS NO.:1095-03-0
Empirical Formula: C18 H15 B O3
Molecular Weight: 290.12
MDL number: MFCD00059011
EINECS: 214-137-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB61.60 | In Stock |
|
| 25G | RMB184.00 | In Stock |
|
| 100G | RMB558.40 | In Stock |
|
| 500G | RMB2270.40 | In Stock |
|
| 2.5kg | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-101 °C (lit.) |
| Boiling point: | 158°C/0.05mmHg(lit.) |
| Density | 1.134±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere |
| solubility | Soluble in chloroform, methanol. |
| form | Solid |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C18H15BO3/c1-4-10-16(11-5-1)20-19(21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H |
| InChIKey | MDCWDBMBZLORER-UHFFFAOYSA-N |
| SMILES | B(OC1C=CC=CC=1)(OC1C=CC=CC=1)OC1C=CC=CC=1 |
Description and Uses
Triphenyl borate is a useful boronic ester with chemosterilant activity against Cochliomyia hominivorax. It is also used as a competitive inhibitor of urease of Klebsiella aerogenes used to study the mechanisms of interaction with the nickel active site.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H318 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-41 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | ED5775000 |
| HS Code | 2931.90.6000 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 |







