A8022612
Thiocholesterol , 1249-81-6
Synonym(s):
5-Cholestene-3β-thiol;Cholesteryl mercaptan
CAS NO.：1249-81-6
Empirical Formula: C27H46S
Molecular Weight: 402.72
MDL number: MFCD00003647
EINECS: 215-003-4
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB399.20 | In Stock |
|
| 250mg | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-99 °C (lit.) |
| Boiling point: | 482.4±24.0 °C(Predicted) |
| Density | 0.98±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| pka | 10.71±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D 23°, c = 1 in chloroform |
| Stability: | Air Sensitive |
| InChIKey | QGVQZRDQPDLHHV-DPAQBDIFSA-N |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](S)CC[C@]4(C)[C@H]3CC[C@]12C |
| LogP | 11.330 (est) |
| EPA Substance Registry System | Cholest-5-ene-3-thiol, (3.beta.)- (1249-81-6) |
Description and Uses
Thiocholesterol is a compound used in biological cross-linking and membrane studies.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
