A8024312
α,α,α′,α′-Tetrabromo-<I>o</I>-xylene , 97% , 13209-15-9
Synonym(s):
1,2-Bis(dibromomethyl)benzene
CAS NO.:13209-15-9
Empirical Formula: C8H6Br4
Molecular Weight: 421.75
MDL number: MFCD00000131
EINECS: 236-176-2
| Pack Size | Price | Stock | Quantity |
| 50g | RMB535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116 °C(lit.) |
| Boiling point: | 303.01°C (rough estimate) |
| Density | 2.2654 (rough estimate) |
| refractive index | 1.7040 (estimate) |
| storage temp. | Store below +30°C. |
| form | Liquid or Low Melting Solid |
| color | Clear colorless to yellow |
| Water Solubility | Insoluble |
| BRN | 2211698 |
| InChI | InChI=1S/C8H6Br4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,7-8H |
| InChIKey | LNAOKZKISWEZNY-UHFFFAOYSA-N |
| SMILES | C1(C(Br)Br)=CC=CC=C1C(Br)Br |
| CAS DataBase Reference | 13209-15-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2-Bis(dibromomethyl)benzene (13209-15-9) |
Description and Uses
α,α,α′,α′-Tetrabromo-o-xylene can be employed as a precursor for the synthesis of:
- Poly(o-phenylene vinylene) (o-PPV) via electrochemical polymerization.
- A pentacene derivative by reacting with naphthalene moieties for the development of organic thin-film transistors (OTFTs).
- Bitopic pyrazole containing ligands.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H314-H335-H400 |
| Precautionary statements | P260-P271-P273-P280-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-36/37-20/21/22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 19-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |









