A8037612
3-(Trifluoromethyl)-<SC>DL</SC>-phenylglycine , 98% , 242475-26-9
Synonym(s):
(±)-2-Amino-2-[3-(trifluoromethyl)phenyl]acetic acid
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB79.20 | In Stock |
|
| 1g | RMB82.40 | In Stock |
|
| 5g | RMB334.40 | In Stock |
|
| 10g | RMB719.20 | In Stock |
|
| 25g | RMB1196.80 | In Stock |
|
| 100g | RMB4503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 274℃ |
| Density | 1.415 |
| Flash point: | 120℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Solid |
| pka | 1.79±0.10(Predicted) |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | 1S/C9H8F3NO2/c10-9(11,12)6-3-1-2-5(4-6)7(13)8(14)15/h1-4,7H,13H2,(H,14,15) |
| InChIKey | SRHNOGZIXICHOU-UHFFFAOYSA-N |
| SMILES | NC(C(O)=O)c1cccc(c1)C(F)(F)F |
| CAS DataBase Reference | 242475-26-9(CAS DataBase Reference) |
Description and Uses
2-Amino-2-(3-(trifluoromethyl)phenyl)acetic Acid is useful reagent for studying selective inhibitors of the interaction of individual nuclear hormone receptors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
