A8039712
2,3,5,6-<WBR>Tetrafluoropyridine , 95% , 2875-18-5
CAS NO.：2875-18-5
Empirical Formula: C5HF4N
Molecular Weight: 151.06
MDL number: MFCD00011734
EINECS: 622-979-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB60.00 | In Stock |
|
| 5g | RMB168.80 | In Stock |
|
| 10g | RMB307.20 | In Stock |
|
| 25g | RMB649.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 102 °C (lit.) |
| Density | 1.499 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 87 °F |
| storage temp. | Inert atmosphere,2-8°C |
| pka | -10.94±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.52 |
| InChI | InChI=1S/C5HF4N/c6-2-1-3(7)5(9)10-4(2)8/h1H |
| InChIKey | HWIPMBCMGVXOKN-UHFFFAOYSA-N |
| SMILES | C1(F)=NC(F)=C(F)C=C1F |
| CAS DataBase Reference | 2875-18-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 2,3,5,6-tetrafluoro-(2875-18-5) |
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F,C |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 28-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
