A8044012
4-<WBR>(Trifluoromethyl)<WBR>mandelic acid , 98% , 395-35-7
CAS NO.：395-35-7
Empirical Formula: C9H7F3O3
Molecular Weight: 220.15
MDL number: MFCD00009724
EINECS: 206-900-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB74.40 | In Stock |
|
| 5g | RMB208.00 | In Stock |
|
| 25g | RMB795.20 | In Stock |
|
| 100g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-134 °C |
| Boiling point: | 324.2±37.0 °C(Predicted) |
| Density | 1.3670 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.06±0.10(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| BRN | 2979949 |
| InChI | 1S/C9H7F3O3/c10-9(11,12)6-3-1-5(2-4-6)7(13)8(14)15/h1-4,7,13H,(H,14,15) |
| InChIKey | SDGXYUQKJPFLDG-UHFFFAOYSA-N |
| SMILES | OC(C(O)=O)c1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 395-35-7(CAS DataBase Reference) |
Description and Uses
Bismuth-catalyzed oxidation of 4-(trifluoromethyl)mandelic acid has been reported.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
