A8049012
Tetrahydro-<WBR>2-<WBR>methyl-<WBR>3-<WBR>thioxo-<WBR>1,2,4-<WBR>triazine-<WBR>5,6-<WBR>dione , 97% , 58909-39-0
CAS NO.:58909-39-0
Empirical Formula: C4H5N3O2S
Molecular Weight: 159.17
MDL number: MFCD00185756
EINECS: 261-490-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB122.40 | In Stock |
|
| 25G | RMB496.00 | In Stock |
|
| 100g | RMB1581.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-171 °C (lit.) |
| Density | 1.62±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 5.34±0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C4H5N3O2S/c1-7-4(10)5-2(8)3(9)6-7/h1H3,(H,6,9)(H,5,8,10) |
| InChIKey | UMWWHOXOVPIGFD-UHFFFAOYSA-N |
| SMILES | N1C(=O)C(=O)NC(=S)N1C |
| CAS DataBase Reference | 58909-39-0(CAS DataBase Reference) |
Description and Uses
Thiotriazinone can be used in the preparation of Cefalosporins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36 |
| Safety Statements | 36-26 |
| WGK Germany | 3 |
| HS Code | 29336990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |



![(6R-trans)-7-amino-8-oxo-3-[[(1,2,5,6-tetrahydro-2-methyl-5,6-dioxo-1,2,4-triazin-3-yl)thio]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/58909-56-1.gif)


