PRODUCT Properties
| Melting point: | 28-30 °C (lit.) |
| Boiling point: | 75 °C/2 mmHg (lit.) |
| Density | 1.704 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | solid |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C4Cl4S/c5-1-2(6)4(8)9-3(1)7 |
| InChIKey | WZXXZHONLFRKGG-UHFFFAOYSA-N |
| SMILES | C1(Cl)SC(Cl)=C(Cl)C=1Cl |
| CAS DataBase Reference | 6012-97-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Thiophene, tetrachloro-(6012-97-1) |
| EPA Substance Registry System | Tetrachlorothiophene (6012-97-1) |
Description and Uses
Tetrachlorothiophene was used in the preparation of 3,4,5-trichloro-2-thiophenecarbonyl chloride.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331 |
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352+P312-P304+P340+P311 |
| Hazard Codes | T |
| Risk Statements | 23/24/25 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XN0350000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2934999090 |
| Toxicity | LD50 oral in rat: 70mg/kg |
