A8133612
tert-butyl (2R)-2-methylpiperazine-1-carboxylate , 97% , 170033-47-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.20 | In Stock |
|
| 5g | RMB179.20 | In Stock |
|
| 25g | RMB678.24 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-36 °C |
| Boiling point: | 268.7±15.0 °C(Predicted) |
| Density | 0.997±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | solid |
| pka | 8.49±0.40(Predicted) |
| color | White crrystalline |
| InChI | InChI=1S/C10H20N2O2/c1-8-7-11-5-6-12(8)9(13)14-10(2,3)4/h8,11H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | DATRVIMZZZVHMP-MRVPVSSYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCNC[C@H]1C |
Description and Uses
(R)-1-Boc-2-methylpiperazine is a reagent in the synthesis of potent and bioavailable inhibitors of Na+/H+ enxchanger type 3 used in the treatment of sleep apneas.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| RIDADR | UN3077 |
| HS Code | 2933599590 |
