A8212412
Iron(III) meso-tetraphenylporphine chloride , 95% , 16456-81-8
CAS NO.：16456-81-8
Empirical Formula: C44H28ClFeN4
Molecular Weight: 704.03
MDL number: MFCD00012152
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB224.80 | In Stock |
|
| 1G | RMB516.80 | In Stock |
|
| 5G | RMB1895.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| color | purple |
| Water Solubility | Insoluble in water. |
| λmax | 418 nm |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| InChIKey | ZDYSAMCSFRQDMN-XBZZRTMISA-M |
| SMILES | [Cl-][Fe+3]123N4C5C=CC=4C(C4C=CC=CC=4)=C4C=CC(=C(C6C=CC=CC=6)C6C=CC(=C(C7C=CC=CC=7)C7=CC=C(C=5C5C=CC=CC=5)[N-]17)N2=6)[N-]34 |
| CAS DataBase Reference | 16456-81-8 |
Description and Uses
Iron(III) meso-tetraphenylporphine chloride is used catalyzing reagent for silylation reactions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
