A8213112
Tetraethylammonium hexafluorophosphate , 98% , 429-07-2
CAS NO.：429-07-2
Empirical Formula: C8H20F6NP
Molecular Weight: 275.22
MDL number: MFCD00043179
EINECS: 207-056-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB69.60 | In Stock |
|
| 25G | RMB196.00 | In Stock |
|
| 100G | RMB738.40 | In Stock |
|
| 500G | RMB3519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C (lit.) |
| storage temp. | Storage temp. 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystalline |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in water, alcohol, and acetonitrile. |
| Sensitive | Hygroscopic |
| BRN | 3748868 |
| InChI | InChI=1S/C8H20N.F6P/c1-5-9(6-2,7-3)8-4;1-7(2,3,4,5)6/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | KLKUOIXSIDDDCN-UHFFFAOYSA-N |
| SMILES | [P-](F)(F)(F)(F)(F)F.[N+](CC)(CC)(CC)CC |
Description and Uses
It is used extensively in electrolytes for electrochemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | BS6500000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29239000 |
