PRODUCT Properties
| Melting point: | -59°C |
| Boiling point: | 245-246°C |
| Density | 0,891 g/cm3 |
| vapor pressure | 0.27Pa at 20℃ |
| refractive index | 1.3948 |
| Flash point: | 75°C |
| storage temp. | 2-8°C |
| solubility | soluble in Benzene |
| form | liquid |
| Specific Gravity | 0.8910 |
| color | Colorless to Almost colorless |
| Water Solubility | 2.3ng/L at 20℃ |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| InChI | 1S/C14H42O5Si6/c1-20(2,3)15-22(7,8)17-24(11,12)19-25(13,14)18-23(9,10)16-21(4,5)6/h1-14H3 |
| InChIKey | ADANNTOYRVPQLJ-UHFFFAOYSA-N |
| SMILES | [Si](O[Si](O[Si](O[Si](C)(C)C)(C)C)(C)C)(O[Si](O[Si](C)(C)C)(C)C)(C)C |
| LogP | 9.41 at 25℃ |
| EPA Substance Registry System | Hexasiloxane, tetradecamethyl- (107-52-8) |
Description and Uses
As a basis for silicone oils or fluids designed to withstand extremes of temp; as a foam suppressant in petroleum lubricating oil.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 2931.90.6000 |
| Storage Class | 10 - Combustible liquids |
