A8257212
Tetradecafluorohexane , 98%(mixtureofisomers) , 355-42-0
Synonym(s):
Perfluorohexane
CAS NO.:355-42-0
Empirical Formula: C6F14
Molecular Weight: 338.04
MDL number: MFCD00000437
EINECS: 206-585-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB44.00 | In Stock |
|
| 25G | RMB148.80 | In Stock |
|
| 100g | RMB371.20 | In Stock |
|
| 500g | RMB1575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −4 °C(lit.) |
| Boiling point: | 58-60 °C(lit.) |
| Density | 1.669 g/mL at 25 °C(lit.) |
| vapor pressure | 26.5kPa at 25℃ |
| refractive index | n |
| Flash point: | 56-60°C |
| form | Liquid |
| Specific Gravity | 1.699 |
| color | Clear colorless |
| Water Solubility | Immiscible with water. |
| Merck | 14,7157 |
| BRN | 1802113 |
| Dielectric constant | 1.5700000000000001 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | SOLVENT |
| InChI | 1S/C6F14/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)20 |
| InChIKey | ZJIJAJXFLBMLCK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| LogP | 4.5 at 20℃ and pH7 |
| Surface tension | 11.91mN/m at 20°C |
| CAS DataBase Reference | 355-42-0(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorohexane (355-42-0) |
Description and Uses
Tetradecafluorohexane has been used:
- as a fluorocarbon organic solvent in the preparation of temperature-induced phase-separation solution
- to investigate boiling heat transfer mechanisms
- as a photosensitizer in fluorous biphasic singlet oxygenation
- as a novel reaction medium for photooxidation reactions
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H412 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | MO4310000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29033990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 |
| Hazardous Substances Data | 355-42-0(Hazardous Substances Data) |







