A6771212
1H,1H,2H,2H-Perfluorodecyltrichlorosilane , 96% , 78560-44-8
Synonym(s):
;F-DTS;p-DTS(FBTTh2)2
CAS NO.:78560-44-8
Empirical Formula: C10H4Cl3F17Si
Molecular Weight: 581.56
MDL number: MFCD00042344
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB97.60 | In Stock |
|
| 25G | RMB332.00 | In Stock |
|
| 100G | RMB1117.60 | In Stock |
|
| 500g | RMB4471.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 10-11°C |
| Boiling point: | 224 °C |
| Density | 1.7 |
| refractive index | 1.349 |
| Flash point: | >110°C |
| solubility | Miscible with tetrahydrofuran, tetrhydropyran, toluene and other organic solvents. |
| form | solid |
| Specific Gravity | 1.7 |
| λmax | 590 nm in chloroform |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 5889653 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C10H4Cl3F17Si/c11-31(12,13)2-1-3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)30/h1-2H2 |
| InChIKey | VIFIHLXNOOCGLJ-UHFFFAOYSA-N |
| SMILES | [Si](Cl)(Cl)(Cl)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 78560-44-8(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)- (78560-44-8) |
Description and Uses
1H,1H,2H,2H-Perfluorodecyltrichlorosilane (CAS# 78560-44-8) is a useful compound used as part of antireflective coatings for solar cell efficiency improvement. The high level of hydrophobicity of 1H,1H,2H,2H-Perfluorodecyltrichlorosilane also makes it useful as coating for electrical insulators.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| Hazard Note | Corrosive/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319090 |






