A8285812
Trichloro(1<i>H</i>,1<i>H</i>,2<i>H</i>,2<i>H</i>-tridecafluoro-<i>n</i>-octyl)silane , >95.0%(GC) , 78560-45-9
Synonym(s):
1H,1H,2H,2H-Perfluorooctyl-trichlorosilane;Trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
CAS NO.:78560-45-9
Empirical Formula: C8H4Cl3F13Si
Molecular Weight: 481.54
MDL number: MFCD00042363
EINECS: 278-947-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB263.20 | In Stock |
|
| 25G | RMB1151.20 | In Stock |
|
| 50g | RMB1903.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -32°C |
| Boiling point: | 192 °C(lit.) |
| Density | 1.3 g/mL at 25 °C(lit.) |
| vapor pressure | 0.007-30Pa at 25℃ |
| refractive index | n |
| Flash point: | 189 °F |
| storage temp. | Storage temp. 2-8°C |
| solubility | Miscible with tetrahydrofuran, tetrhydropyran, toluene and other organic solvents. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.3 |
| Water Solubility | 580μg/L at 20℃ |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 6154526 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents, water, alcohols, bases. |
| InChI | 1S/C8H4Cl3F13Si/c9-25(10,11)2-1-3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24/h1-2H2 |
| InChIKey | PISDRBMXQBSCIP-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)Cl |
| LogP | 2.7 at 20℃ |
| CAS DataBase Reference | 78560-45-9(CAS DataBase Reference) |
| EPA Substance Registry System | Trichloro((perfluorohexyl)ethyl)silane (78560-45-9) |
Description and Uses
1H,1H,2H,2H-Perfluorooctyltrichlorosilane is used in the silanization of silicon wafer. Self assembled monolayers treated with this, acts as an anti adhesive layer and release of cured poly(dimethyl siloxanes). It is also used to fabricate chemical surface patterns of self assembled monolayers.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive/Moisture Sensitive |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |







