A8260212
4-(Trifluoromethyl)anisole , 98% , 402-52-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB39.20 | In Stock |
|
| 1g | RMB64.00 | In Stock |
|
| 5G | RMB224.80 | In Stock |
|
| 25G | RMB638.40 | In Stock |
|
| 100g | RMB1876.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -9℃ |
| Boiling point: | 169℃/754mm |
| Density | 1.245 |
| refractive index | 1.4450 |
| Flash point: | 60°(140°F) |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Colorless to pale yellow |
| InChI | InChI=1S/C8H7F3O/c1-12-7-4-2-6(3-5-7)8(9,10)11/h2-5H,1H3 |
| InChIKey | CFIPQRIPCRRISV-UHFFFAOYSA-N |
| SMILES | C1(OC)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 402-52-8(CAS DataBase Reference) |
Description and Uses
4-(Trifluoromethyl)anisole is used as a pharmaceutical and pesticide intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P261-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 10 |
| Safety Statements | 16-33 |
| RIDADR | 1993 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| HS Code | 2909309090 |






