A8264212
1,2,3,4-Tetrahydro-2-naphthoic acid , 97% , 53440-12-3
Synonym(s):
Tetralin-2-carboxylic acid
CAS NO.:53440-12-3
Empirical Formula: C11H12O2
Molecular Weight: 176.21
MDL number: MFCD00001741
EINECS: 258-553-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB187.20 | In Stock |
|
| 1G | RMB584.00 | In Stock |
|
| 5g | RMB1518.40 | In Stock |
|
| 25g | RMB6573.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-96 °C (lit.) |
| Boiling point: | 267.83°C (rough estimate) |
| Density | 1.0558 (rough estimate) |
| refractive index | 1.5425 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| pka | 4.57±0.20(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 2050435 |
| InChI | InChI=1S/C11H12O2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7H2,(H,12,13) |
| InChIKey | NTAGXJQHJQUOOA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)CCC1C(O)=O |
Description and Uses
1,2,3,4-Tetrahydro-2-naphthoic Acid is used as a reagent in organic synthesis of several compounds including that of N-acyl-5-methyl-3(2H)-isoxazolone derivatives which show high potential as fungicides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






