A8266412
Tantalum(V) Ethoxide , 99% , 6074-84-6
Synonym(s):
PET;Pentaethoxytantalum;Tantalum pentaethoxide;Tantalum(V) ethoxide;Tantalum ethylate
CAS NO.:6074-84-6
Empirical Formula: C10H25O5Ta
Molecular Weight: 406.25
MDL number: MFCD00049785
EINECS: 228-010-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 5G | RMB395.20 | In Stock |
|
| 25G | RMB1623.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 21 °C(lit.) |
| Boiling point: | 155 °C0.01 mm Hg(lit.) |
| Density | 1.566 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 87 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in organic solvents. |
| form | liquid |
| Specific Gravity | 1.56 |
| Water Solubility | Decomposes in water. Soluble in organic solvents. |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive/Air Sensitive |
| BRN | 3678999 |
| InChI | 1S/5C2H5O.Ta/c5*1-2-3;/h5*2H2,1H3;/q5*-1;+5 |
| InChIKey | HSXKFDGTKKAEHL-UHFFFAOYSA-N |
| SMILES | CCO[Ta](OCC)(OCC)(OCC)OCC |
| CAS DataBase Reference | 6074-84-6(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanol, tantalum(5+) salt (6074-84-6) |
Description and Uses
Tantalum(V) ethoxide acts as a precursor used in the preparation of ultra thin films of tantalum oxide and other tantalum containing films, which finds application in semiconductors. It is also used to prepare tantalum oxide nanoparticles for the imaging cartilage.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241-P242-P243 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F |
| Risk Statements | 10-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| F | 3-8-10-21 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2905190019 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







