BD0461753
Tantalum(v)butoxide , 98% , 51094-78-1
Synonym(s):
Pentabutoxytantalum
CAS NO.:51094-78-1
Empirical Formula: C20H45O5Ta
Molecular Weight: 546.52
MDL number: MFCD00078035
EINECS: 256-962-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB162.40 | In Stock |
|
| 5g | RMB487.20 | In Stock |
|
| 25g | RMB2040.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 217°C 0,15mm |
| Density | 1.31 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 105 °F |
| form | liquid |
| Specific Gravity | 1.310 |
| color | colorless to light yellow |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | air sensitive, moisture sensitive |
| InChI | InChI=1S/5C4H9O.Ta/c5*1-2-3-4-5;/h5*2-4H2,1H3;/q5*-1;+5 |
| InChIKey | QORWLRPWMJEJKP-UHFFFAOYSA-N |
| SMILES | [Ta](OCCCC)(OCCCC)(OCCCC)(OCCCC)OCCCC |
| EPA Substance Registry System | 1-Butanol, tantalum(5+) salt (51094-78-1) |
Description and Uses
Tantalum alkoxides are useful as starting materials for tantalum oxides for dielectrics.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |








