S977378
Pentakis(dimethylamino)tantalum(V) , 99.99% , 19824-59-0
Synonym(s):
PDMAT;Ta(NMe2)5;TADMA;Tantalum dimethylamide
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2427.38 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100 °C (dec.)(lit.) |
| Boiling point: | 100°C 0,1mm |
| form | crystal |
| color | orange |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | moisture sensitive |
| InChI | InChI=1S/5C2H6N.Ta/c5*1-3-2;/h5*1-2H3;/q5*-1;+5 |
| InChIKey | VSLPMIMVDUOYFW-UHFFFAOYSA-N |
| SMILES | [Ta](N(C)C)(N(C)C)(N(C)C)(N(C)C)N(C)C |
| CAS DataBase Reference | 19824-59-0 |
Description and Uses
Pentakis(dimethylamino)tantalum (PDMAT) was used as a tantalum source with either ammonia or monomethylhydrazine (MMH) as a nitrogen co-reactant.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H228-H260-H314 |
| Precautionary statements | P210-P231+P232-P260-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,C |
| Risk Statements | 11-14/15-34 |
| Safety Statements | 16-26-36/37/39-43-45 |
| RIDADR | UN 3131 4.3/PG 1 |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Dam. 1 Flam. Sol. 1 Skin Corr. 1B Water-react 1 |







