A8322412
Undecanoyl chloride , 97% , 17746-05-3
Synonym(s):
Undecanoyl chloride
CAS NO.:17746-05-3
Empirical Formula: C11H21ClO
Molecular Weight: 204.74
MDL number: MFCD00000739
EINECS: 241-741-1
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB31.20 | In Stock |
|
| 5ML | RMB83.20 | In Stock |
|
| 25ML | RMB300.00 | In Stock |
|
| 100ml | RMB788.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 135-136 °C/20 mmHg (lit.) |
| Density | 0.93 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | −20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 0.93 |
| Sensitive | Moisture Sensitive |
| BRN | 1759226 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C11H21ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3 |
| InChIKey | JUKPJGZUFHCZQI-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)CCCCCCCCCC |
| CAS DataBase Reference | 17746-05-3(CAS DataBase Reference) |
| EPA Substance Registry System | Undecanoyl chloride (17746-05-3) |
Description and Uses
Undecanoyl chloride has been used in the synthesis of:
- chrysotrione B, 2-acylcyclopentene-1,3-dione derivative, isolated from the fruiting bodies of the basidiomycete Hygrophorus chrysodon
- 2-methylpentadecan-5-one
- 4-ketotetradecanoic acid
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| TSCA | TSCA listed |
| HS Code | 2915 90 70 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |



