A8323812
5′-UMP-Na2 , 99% , 3387-36-8
Synonym(s):
5′-UMP-Na2;U 5′-P;UMP;Uridine 5′-monophosphate disodium salt;Uridylic acid disodium salt
CAS NO.:3387-36-8
Empirical Formula: C9H11N2Na2O9P
Molecular Weight: 368.14
MDL number: MFCD00006525
EINECS: 222-211-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 100G | RMB231.20 | In Stock |
|
| 500g | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210 °C |
| refractive index | -14 ° (C=1, H2O) |
| storage temp. | 2-8°C |
| solubility | Water (Slightly) |
| form | Crystalline Powder |
| pka | 6.4, 9.5(at 25℃) |
| color | White |
| biological source | (chemical) |
| Water Solubility | 40 g/100 mL (20 ºC) |
| BRN | 3582885 |
| Stability: | Very Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1/C9H13N2O9P.Na.H/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18;;/h1-2,4,6-8,13-14H,3H2,(H,10,12,15)(H2,16,17,18);;/t4-,6-,7-,8-;;/s3 |
| InChIKey | KURVIXMFFSNONZ-WFIJOQBCSA-L |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(O)=O)O[C@H]1N1C=CC(=O)NC1=O)O.[NaH] |&1:1,2,3,11,r| |
| CAS DataBase Reference | 3387-36-8(CAS DataBase Reference) |
Description and Uses
Uridine 5'-monophosphate disodium salt (UMP-Na2) is a major component of RNA, a nucleotide. It is found in dietary supplements as well as in natural foods rich in RNA and has been shown to enhance cognitive function in animals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H332-H302-H312 |
| Precautionary statements | P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501-P280-P302+P352-P312-P322-P363-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 2 |
| RTECS | YU7975000 |
| F | 10-21 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |







