A8326032
3-Amino-1H-indazole , 97% , 874-05-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1g | RMB36.80 | In Stock |
|
| 5g | RMB126.40 | In Stock |
|
| 25G | RMB473.60 | In Stock |
|
| 100g | RMB1416.80 | In Stock |
|
| 500g | RMB5268.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-157°C |
| Boiling point: | 376.6±15.0 °C(Predicted) |
| Density | 1.367±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 14.89±0.40(Predicted) |
| form | Liquid or Solid |
| color | Clear, colorless or white to pale yellow |
| InChI | InChI=1S/C7H7N3/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H3,8,9,10) |
| InChIKey | YDTDKKULPWTHRV-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(N)=N1 |
| CAS DataBase Reference | 874-05-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Indazol-3-amine (874-05-5) |
Description and Uses
1H-Indazol-3-amine is a reagent used in the preparation of indazole derivatives as potential antimicrobial and antitumor agents.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 34-25-36/37/38-22 |
| Safety Statements | 26-36/37/39-45-22 |
| RIDADR | 3259 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






