A8332112
6-Undecanone , >98.0%(GC) , 927-49-1
Synonym(s):
Diamyl ketone;Dipentyl ketone
CAS NO.：927-49-1
Empirical Formula: C11H22O
Molecular Weight: 170.29
MDL number: MFCD00009516
EINECS: 213-150-9
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB38.40 | In Stock |
|
| 25ML | RMB141.60 | In Stock |
|
| 100ML | RMB468.00 | In Stock |
|
| 500ml | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 14.6 °C(lit.) |
| Boiling point: | 228 °C(lit.) |
| Density | 0.831 g/mL at 25 °C(lit.) |
| FEMA | 4022 | 6-UNDECANONE |
| refractive index | n |
| Flash point: | 191 °F |
| storage temp. | Store at room temperature |
| form | liquid |
| color | Colorless to Light yellow to Light orange |
| JECFA Number | 1155 |
| InChI | InChI=1S/C11H22O/c1-3-5-7-9-11(12)10-8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | ZPQAKYPOZRXKFA-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)CCCCC |
| LogP | 4.09 |
| CAS DataBase Reference | 927-49-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 6-Undecanone(927-49-1) |
| EPA Substance Registry System | 6-Undecanone (927-49-1) |
Description and Uses
6-Undecanone was used in systematic screening of various organic solvents used as supported liquid membranes in electromembrane extraction.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | YQ2828000 |
| Hazard Note | Irritant |
| HS Code | 29141990 |
