A8332612
10-Undecynoic Acid , >98.0%(GC) , 2777-65-3
CAS NO.：2777-65-3
Empirical Formula: C11H18O2
Molecular Weight: 182.26
MDL number: MFCD00014389
EINECS: 220-471-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB239.20 | In Stock |
|
| 5G | RMB463.20 | In Stock |
|
| 25g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-42 °C (lit.) |
| Boiling point: | 180 °C/15 mmHg (lit.) |
| Density | 0.9898 (rough estimate) |
| refractive index | 1.4066 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | 4.78±0.10(Predicted) |
| color | Off-White |
| Water Solubility | Sparingly Soluble in water. |
| BRN | 1704918 |
| InChI | InChI=1S/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| InChIKey | OAOUTNMJEFWJPO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCCC#C |
| CAS DataBase Reference | 2777-65-3(CAS DataBase Reference) |
| EPA Substance Registry System | 10-Undecynoic acid (2777-65-3) |
Description and Uses
10-Undecynoic Acid is a fatty acid used in the synthesis of copolyesters.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | YQ3683000 |
| F | 10-23 |
| HS Code | 29161900 |
| Toxicity | mouse,LD50,intravenous,32mg/kg (32mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#07969, |
